CAS 133366-27-5
:7-benzyl-1-oxa-7-azaspiro[4.4]nonan-2-one
Description:
7-benzyl-1-oxa-7-azaspiro[4.4]nonan-2-one is a chemical compound characterized by its unique spirocyclic structure, which features a combination of a nitrogen atom and an oxygen atom within its framework. This compound belongs to a class of heterocycles, which are known for their diverse biological activities and potential applications in medicinal chemistry. The presence of the benzyl group contributes to its lipophilicity, potentially enhancing its ability to permeate biological membranes. The spirocyclic nature of the molecule may also impart rigidity, influencing its conformational properties and interactions with biological targets. Additionally, the ketone functional group suggests potential reactivity, making it a candidate for further chemical modifications. Overall, 7-benzyl-1-oxa-7-azaspiro[4.4]nonan-2-one exhibits characteristics that may be of interest in drug development and synthetic chemistry, although specific biological activities and applications would require further investigation.
Formula:C14H17NO2
InChI:InChI=1/C14H17NO2/c16-13-6-7-14(17-13)8-9-15(11-14)10-12-4-2-1-3-5-12/h1-5H,6-11H2
Synonyms:- 7-Benzyl-1-oxa-7-azaspiro[4.4]nonan-2-on
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.