
CAS 13337-72-9
:Decahydro-4-quinolinecarboxylic acid
Description:
Decahydro-4-quinolinecarboxylic acid, with the CAS number 13337-72-9, is a bicyclic compound characterized by its unique structure that includes a quinoline moiety. This substance typically appears as a solid at room temperature and is known for its relatively high solubility in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid functional group. The compound exhibits properties typical of carboxylic acids, including the ability to form hydrogen bonds, which contributes to its solubility and reactivity. It may participate in various chemical reactions, such as esterification and amidation, making it useful in organic synthesis and pharmaceutical applications. Additionally, its bicyclic structure may impart specific biological activities, which could be of interest in medicinal chemistry. Overall, Decahydro-4-quinolinecarboxylic acid is a versatile compound with potential applications in various fields, including drug development and material science.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h7-9,11H,1-6H2,(H,12,13)
InChI key:InChIKey=KOHCZICXYWAFTC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C2C(NCC1)CCCC2
Synonyms:- Decahydroquinoline-4-carboxylic acid
- Cinchoninic acid, decahydro-
- 4-Quinolinecarboxylic acid, decahydro-
- Decahydro-4-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.