
CAS 13337-76-3
:Methyl 7-chloro-4-quinolinecarboxylate
Description:
Methyl 7-chloro-4-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 7-position of the quinoline ring enhances its biological activity and may influence its interaction with various biological targets. Methyl 7-chloro-4-quinolinecarboxylate is often studied for its potential applications in medicinal chemistry, particularly in the development of antimicrobial and antimalarial agents. Its molecular structure allows for various chemical modifications, which can lead to derivatives with improved efficacy or reduced toxicity. Additionally, this compound may exhibit fluorescence properties, making it useful in analytical chemistry and biological imaging. As with many quinoline derivatives, it is essential to handle this compound with care, considering its potential biological effects and the need for appropriate safety measures during experimentation.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c1-15-11(14)9-4-5-13-10-6-7(12)2-3-8(9)10/h2-6H,1H3
InChI key:InChIKey=SBFUSSPRZNFRTJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(N=CC1)C=C(Cl)C=C2
Synonyms:- Methyl 7-chloro-4-quinolinecarboxylate
- Cinchoninic acid, 7-chloro-, methyl ester
- 7-Chloroquinoline-4-carboxylic acid methyl ester
- 4-Quinolinecarboxylic acid, 7-chloro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.