CAS 133373-32-7

Methyl 2-chloro-α-hydroxybenzenepropanoate

Description:

Methyl 2-chloro-α-hydroxybenzenepropanoate, identified by its CAS number 133373-32-7, is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a chloro substituent on the aromatic ring, specifically at the 2-position, and a hydroxy group at the α-position relative to the propanoate moiety. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis. Methyl 2-chloro-α-hydroxybenzenepropanoate may exhibit moderate polarity due to the hydroxyl group, influencing its solubility in various solvents. Additionally, the chlorine atom can impart unique chemical properties, such as increased electrophilicity, making it a useful intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, this compound is of interest in medicinal chemistry and materials science for its potential utility in various chemical transformations.

Formula: C₁₀H₁₁ClO₃

InChI: InChI=1S/C10H11ClO3/c1-14-10(13)9(12)6-7-4-2-3-5-8(7)11/h2-5,9,12H,6H2,1H3

InChI key: InChIKey=AXKSNCDIFRBHOQ-UHFFFAOYSA-N

SMILES: C(C(C(OC)=O)O)C1=C(Cl)C=CC=C1

Synonyms:

• Benzenepropanoic acid, 2-chloro-α-hydroxy-, methyl ester
• Methyl 2-chloro-α-hydroxybenzenepropanoate