CAS 133378-42-4
:Hydrazinecarbothioamide, N-(3-chloro-4-fluorophenyl)-
Description:
Hydrazinecarbothioamide, N-(3-chloro-4-fluorophenyl)-, identified by its CAS number 133378-42-4, is a chemical compound that features a hydrazinecarbothioamide functional group attached to a substituted aromatic ring. This compound typically exhibits characteristics associated with both hydrazine derivatives and thioamide functionalities, which may include moderate to high reactivity due to the presence of the hydrazine moiety. The chloro and fluoro substituents on the phenyl ring can influence its electronic properties, potentially enhancing its reactivity and solubility in various solvents. Such compounds are often of interest in medicinal chemistry and material science due to their potential biological activity and utility in synthesizing other chemical entities. Additionally, the presence of halogen atoms can affect the compound's stability and interaction with biological targets. Safety considerations should be taken into account when handling this compound, as hydrazine derivatives can be toxic and hazardous.
Formula:C7H7ClFN3S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
