CAS 13338-66-4

1,2,3,4-Tetrahydro-6,8-dimethoxy-2-methyl-7-isoquinolinol

Description:

1,2,3,4-Tetrahydro-6,8-dimethoxy-2-methyl-7-isoquinolinol, with the CAS number 13338-66-4, is a chemical compound that belongs to the isoquinoline family. This substance features a tetrahydroisoquinoline structure, which is characterized by a bicyclic system containing a nitrogen atom. The presence of methoxy groups at the 6 and 8 positions contributes to its unique chemical properties, potentially influencing its solubility and reactivity. The methyl group at the 2 position further modifies its electronic characteristics. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential interactions with biological targets, although specific biological activities would require empirical investigation. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1,2,3,4-Tetrahydro-6,8-dimethoxy-2-methyl-7-isoquinolinol represents a complex organic molecule with potential applications in various fields, including drug development and synthetic chemistry.

Formula: C₁₂H₁₇NO₃

InChI: InChI=1S/C12H17NO3/c1-13-5-4-8-6-10(15-2)11(14)12(16-3)9(8)7-13/h6,14H,4-5,7H2,1-3H3

InChI key: InChIKey=ZJUWNYMWJKNZJO-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(OC)=C1O)CCN(C)C2

Synonyms:

• 1,2,3,4-Tetrahydro-6,8-dimethoxy-2-methyl-7-isoquinolinol
• 7-Isoquinolinol, 1,2,3,4-tetrahydro-6,8-dimethoxy-2-methyl-

7-Isoquinolinol, 1,2,3,4-tetrahydro-6,8-dimethoxy-2-methyl-

CAS: 13338-66-4

Formula: C₁₂H₁₇NO₃

Molecular weight: 223.2683

Ref: IN-DA0014R4