CAS 133390-85-9
:5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone
Description:
5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone, identified by its CAS number 133390-85-9, is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound contains a hydroxymethyl group and two methyl groups at the 3-position, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the hydroxymethyl group enhances its solubility in polar solvents, making it useful in various applications, including as a solvent, intermediate in organic synthesis, and in the formulation of pharmaceuticals. Its molecular structure allows for hydrogen bonding, which can influence its reactivity and interactions with other compounds. Additionally, it may exhibit moderate stability under standard conditions, but like many organic compounds, it should be handled with care to avoid degradation or unwanted reactions. Overall, this compound's characteristics make it valuable in both industrial and research settings.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-7(2)3-5(4-9)8-6(7)10/h5,9H,3-4H2,1-2H3,(H,8,10)
InChI key:InChIKey=LAPMHIATPBRNHT-UHFFFAOYSA-N
SMILES:C(O)C1CC(C)(C)C(=O)N1
Synonyms:- 2-Pyrrolidinone, 5-(hydroxymethyl)-3,3-dimethyl-
- 3,3-Dimethyl-5-hydroxymethyl-2-pyrrolidinone
- 5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.