CAS 133391-51-2

1-[2-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone

Description:

1-[2-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone, with the CAS number 133391-51-2, is an organic compound characterized by its unique structure, which includes a phenyl group substituted with a pentafluoroethyl group and an ethanone moiety. This compound is notable for its high fluorine content, which imparts distinctive physical and chemical properties, such as increased hydrophobicity and thermal stability. The presence of the carbonyl group (ketone) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. Additionally, the fluorinated alkyl chain can enhance the compound's lipophilicity, affecting its solubility in organic solvents. Due to its specific functional groups, this compound may exhibit interesting biological activities and could be explored in fields such as medicinal chemistry or materials science. However, detailed studies on its toxicity, environmental impact, and practical applications would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₀H₇F₅O

InChI: InChI=1S/C10H7F5O/c1-6(16)7-4-2-3-5-8(7)9(11,12)10(13,14)15/h2-5H,1H3

InChI key: InChIKey=NJPMPISADIYLCI-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(F)(F)C1=C(C(C)=O)C=CC=C1

Synonyms:

• 1-[2-(1,1,2,2,2-Pentafluoroethyl)phenyl]ethanone
• Ethanone, 1-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-
• Ethanone, 1-[2-(pentafluoroethyl)phenyl]-
• 1-[2-(Pentafluoroethyl)phenyl]ethan-1-one

2’-(Pentafluoroethyl)acetophenone

CAS: 133391-51-2

2’-(Pentafluoroethyl)acetophenone

Purity: ≥95%

Molecular weight: 238.15g/mol

Ref: 54-PC50137