CAS 133393-81-4
:brandioside
Description:
Brandioside, with the CAS number 133393-81-4, is a chemical compound that belongs to the class of glycosides, specifically a type of saponin. It is derived from natural sources, often associated with various plant species. Brandioside is characterized by its complex structure, which typically includes a sugar moiety linked to a hydrophobic aglycone. This structural feature contributes to its surfactant properties, allowing it to interact with biological membranes and potentially exhibit bioactive effects. Brandioside has garnered interest in pharmacological research due to its potential therapeutic applications, including anti-inflammatory and antioxidant activities. Additionally, its role in traditional medicine highlights its significance in ethnopharmacology. However, detailed studies on its mechanism of action, toxicity, and efficacy are still ongoing, necessitating further research to fully understand its properties and potential uses in various fields, including pharmaceuticals and nutraceuticals.
Formula:C37H48O20
InChI:InChI=1/C37H48O20/c1-15-26(44)28(46)30(48)35(52-15)51-14-24-32(56-25(43)9-6-18-4-7-20(39)22(41)12-18)33(57-36-31(49)29(47)27(45)16(2)53-36)34(54-17(3)38)37(55-24)50-11-10-19-5-8-21(40)23(42)13-19/h4-9,12-13,15-16,24,26-37,39-42,44-49H,10-11,14H2,1-3H3/b9-6+
Synonyms:- (beta-(3',4'-Dihydroxyphenyl)ethyl)-(2-O-acetyl)-(3,6-O-di-alpha-L-rhamnopyransoyl)-(4-O-caffeoyl)-beta-D-glucopyranoside
- 2'-O-Acetylpoliumoside
- beta-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-6-deoxy-alpha-L-mannopyranosyl-(1-3)-O-(6-deoxy-alpha-L-mannopyranosyl-(1-6))-, 2-acetate 4-(3-(3,4-dihydroxyphenyl)-2-propenoate), (E)-
- 2-(3,4-dihydroxyphenyl)ethyl 6-deoxyhexopyranosyl-(1->3)-[6-deoxyhexopyranosyl-(1->6)]-2-O-acetyl-4-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]hexopyranoside
- Brandioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Brandioside
CAS:<p>Brandioside (2'-Acetilpoliumoside), estratto da Callicarpa dichotoma Raeuschel, ha attività antiossidante e può essere utilizzato nello studio del diabete.</p>Formula:C37H48O20Purity:98.08%Color and Shape:SolidMolecular weight:812.77Brandioside
CAS:<p>Brandioside is a glycoside compound, which is derived from natural plant sources. It acts by modulating cellular signaling pathways, specifically targeting pathways involved in inflammation and oxidative stress. Through this mechanism, Brandioside exhibits potential therapeutic properties by reducing inflammatory responses and protecting against cellular damage.</p>Formula:C37H48O20Purity:Min. 95%Color and Shape:PowderMolecular weight:812.77 g/mol



