CAS 133395-54-7

Phenazinium, 5-ethyl-1-methoxy-, ethyl sulfate (1:1)

Description:

Phenazinium, 5-ethyl-1-methoxy-, ethyl sulfate (1:1) is a synthetic organic compound characterized by its phenazinium core, which is a bicyclic structure containing nitrogen atoms. This compound features an ethyl group and a methoxy group, contributing to its solubility and reactivity. The presence of the ethyl sulfate moiety indicates that it is a salt, which can enhance its stability and solubility in polar solvents. Typically, phenazinium derivatives exhibit interesting electrochemical properties and can be involved in redox reactions, making them relevant in various applications, including dye chemistry and as potential biological agents. The compound may also display antimicrobial or antifungal activities, common among phenazinium derivatives. Its molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic applications. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₅H₁₅N₂O·C₂H₅O₄S

InChI: InChI=1S/C15H15N2O.C2H6O4S/c1-3-17-12-8-5-4-7-11(12)16-15-13(17)9-6-10-14(15)18-2;1-2-6-7(3,4)5/h4-10H,3H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1

InChI key: InChIKey=KVGKVNWLQAHCMK-UHFFFAOYSA-M

SMILES: C(C)[N+]=1C2=C(N=C3C1C=CC=C3)C(OC)=CC=C2.O(S(=O)(=O)[O-])CC

Synonyms:

• Phenazinium, 5-ethyl-1-methoxy-, ethyl sulfate
• Sulfuric acid, monoethyl ester, ion(1-), 5-ethyl-1-methoxyphenazinium
• Phenazinium, 5-ethyl-1-methoxy-, ethyl sulfate (1:1)