CAS 133399-57-2
:N-(4-pyren-1-ylbutyl)prop-2-enamide
Description:
N-(4-pyren-1-ylbutyl)prop-2-enamide is an organic compound characterized by its unique structure, which includes a pyrene moiety, a butyl chain, and an acrylamide functional group. The presence of the pyrene group imparts significant fluorescence properties, making this compound useful in various applications, including photonics and materials science. The acrylamide functionality allows for potential polymerization, enabling the formation of cross-linked networks or copolymers, which can enhance mechanical properties and thermal stability. This compound is typically soluble in organic solvents, and its reactivity can be influenced by the presence of the double bond in the prop-2-enamide structure, allowing for further chemical modifications. Additionally, the compound's hydrophobic nature due to the pyrene and butyl groups may affect its interactions in biological systems, making it of interest in drug delivery and bioimaging applications. Overall, N-(4-pyren-1-ylbutyl)prop-2-enamide is a versatile compound with significant potential in both research and industrial applications.
Formula:C23H21NO
InChI:InChI=1/C23H21NO/c1-2-21(25)24-15-4-3-6-16-9-10-19-12-11-17-7-5-8-18-13-14-20(16)23(19)22(17)18/h2,5,7-14H,1,3-4,6,15H2,(H,24,25)
SMILES:C=CC(=NCCCCc1ccc2ccc3cccc4ccc1c2c34)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Acryloyl-1-pyrenebutylamine
CAS:N-Acryloyl-1-pyrenebutylamine, a potent fluorescent derivatization agent, imparts fluorescence to polymers when its alkyl-acrylamide side-chain is incorporated.Formula:C23H21NOColor and Shape:SolidMolecular weight:327.42

