
CAS 13341-72-5
:Menthalactone
Description:
Menthalactone, with the CAS number 13341-72-5, is a cyclic monoterpene ketone that is derived from menthol. It is characterized by its pleasant minty aroma, which makes it a valuable compound in the fragrance and flavor industries. Menthalactone typically exists in two isomeric forms, which can exhibit slightly different olfactory properties. The compound is known for its stability and relatively low volatility, contributing to its effectiveness as a flavoring agent in various food products and as a fragrance component in cosmetics and personal care items. Additionally, menthalactone has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. Its solubility in organic solvents and limited solubility in water further influence its applications in formulations. Overall, menthalactone is appreciated for its sensory attributes and potential health benefits, making it a versatile compound in both industrial and consumer products.
Formula:C10H14O2
InChI:InChI=1S/C10H14O2/c1-6-3-4-8-7(2)10(11)12-9(8)5-6/h6,9H,3-5H2,1-2H3
InChI key:InChIKey=VUVQBYIJRDUVHT-UHFFFAOYSA-N
SMILES:CC1=C2C(OC1=O)CC(C)CC2
Synonyms:- 2(4H)-Benzofuranone, 5,6,7,7a-tetrahydro-3,6-dimethyl-
- Dehydroxymenthofurolactone
- Δ1,α-Cyclohexaneacetic acid, 2-hydroxy-α,4-dimethyl-, γ-lactone
- (-)-Dehydroxymenthofuran oxide
- 5,6,7,7a-Tetrahydro-3,6-dimethyl-2(4H)-benzofuranone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
