CAS 133413-70-4
:(3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzyl-4,10,12,16,22,24-hexamethyl-3,9,15,21-tetrakis(2-methylpropyl)-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone
Description:
The chemical substance with the name "(3S,6R,9S,12R,15S,18R,21S,24R)-6,18-dibenzyl-4,10,12,16,22,24-hexamethyl-3,9,15,21-tetrakis(2-methylpropyl)-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone" and CAS number "133413-70-4" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a tetracyclic structure with several chiral centers, indicating that it can exist in multiple stereoisomeric forms. The presence of multiple benzyl and methyl groups contributes to its hydrophobic characteristics, while the tetraoxa and tetraaza components suggest potential solubility in polar solvents and possible coordination chemistry. This compound may exhibit interesting biological activity due to its structural complexity, potentially interacting with biological macromolecules. Its synthesis and characterization would require advanced organic chemistry techniques, and its applications could span fields such as medicinal chemistry, materials science, or catalysis, depending on its specific properties and reactivity.
Formula:C52H76N4O12
InChI:InChI=1/C52H76N4O12/c1-31(2)25-39-49(61)65-35(9)45(57)53(11)42(28-34(7)8)52(64)68-44(30-38-23-19-16-20-24-38)48(60)56(14)40(26-32(3)4)50(62)66-36(10)46(58)54(12)41(27-33(5)6)51(63)67-43(47(59)55(39)13)29-37-21-17-15-18-22-37/h15-24,31-36,39-44H,25-30H2,1-14H3/t35-,36-,39+,40+,41+,42+,43-,44-/m1/s1
Synonyms:- (3S,6R,9S,12R,15S,18R,21S,24R)-4,6,10,16,18,22-Hexamethyl-3,9,15,21-tetrakis(2-methylpropyl)-12,24-bis(phenylmethyl)-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone
- (3S,6R,9S,12R,15S,18R,21S,24R)-6,18-Dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone
- 1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosane-2,5,8,11,14,17,20,23-octone, 4,6,10,16,18,22-hexamethyl-3,9,15,21-tetrakis(2-methylpropyl)-12,24-bis(phenylmethyl)-, (3S,6R,9S,12R,15S,18R,21S,24R)-
- 133413-70-4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
PF 1022A
CAS:<p>PF 1022A is an N-methylated cyclooctadepsipeptides with strong anthelmintic properties. It also acts as an ionosphere.</p>Formula:C52H76N4O12Purity:98%Color and Shape:Wei? (White) Solid Powder CrystallineMolecular weight:949.18PF 1022A
CAS:<p>PF 1022A is a cyclooctadepsipeptide, which is a type of cyclic peptide composed of amino acids and hydroxy acids. It is derived from the fermentation products of the fungus *Mycelia sterilia*, a member of the *Rosellinia* genus. Its mode of action involves disrupting glutamate-gated chloride channels in parasitic nematodes, which leads to paralysis and eventual death of the parasite.</p>Formula:C52H76N4O12Purity:Min. 95%Molecular weight:949.18 g/mol

