CAS 1334136-66-1
:5-Bromo-2-(4-methyl-1-piperazinyl)-3,4-pyridinediamine
Description:
5-Bromo-2-(4-methyl-1-piperazinyl)-3,4-pyridinediamine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a piperazine moiety. This compound features two amino groups, contributing to its potential as a ligand in various chemical reactions. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The piperazine ring, known for its role in pharmacology, can impart properties such as improved solubility and bioavailability. This compound may exhibit various biological activities, including potential applications in drug development, particularly in targeting specific receptors or enzymes. Its molecular structure suggests it could participate in hydrogen bonding and other interactions, which are crucial for its function in biological systems. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C10H16BrN5
InChI:InChI=1S/C10H16BrN5/c1-15-2-4-16(5-3-15)10-9(13)8(12)7(11)6-14-10/h6H,2-5,13H2,1H3,(H2,12,14)
InChI key:InChIKey=IAOONUZRICRTIM-UHFFFAOYSA-N
SMILES:NC1=C(N=CC(Br)=C1N)N2CCN(C)CC2
Synonyms:- 5-Bromo-2-(4-methyl-1-piperazinyl)-3,4-pyridinediamine
- 5-Bromo-2-(4-methylpiperazin-1-yl)pyridine-3,4-diamine
- 3,4-Pyridinediamine, 5-bromo-2-(4-methyl-1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.