CAS 1334145-99-1

1-Butyl-1,2,3,4-tetrahydro-3-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride

Description:

1-Butyl-1,2,3,4-tetrahydro-3-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a pyrido-pyrimidine core, a sulfonyl chloride functional group, and a butyl side chain. This compound typically exhibits properties associated with sulfonyl chlorides, such as high reactivity, particularly towards nucleophiles, making it useful in various chemical reactions, including acylation and sulfonylation. The presence of the dioxopyrido structure suggests potential biological activity, possibly influencing its solubility and interaction with biological targets. Additionally, the butyl group contributes to the lipophilicity of the molecule, which may affect its pharmacokinetic properties if considered for medicinal applications. As with many sulfonyl chlorides, it is likely to be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, this compound's unique structural features and functional groups make it a candidate for further research in synthetic chemistry and potential pharmaceutical applications.

Formula: C₁₂H₁₄ClN₃O₄S

InChI: InChI=1S/C12H14ClN3O4S/c1-3-4-5-16-10-9(11(17)15(2)12(16)18)6-8(7-14-10)21(13,19)20/h6-7H,3-5H2,1-2H3

InChI key: InChIKey=NOXQAIGXTGXMBB-UHFFFAOYSA-N

SMILES: C(CCC)N1C=2C(=CC(S(Cl)(=O)=O)=CN2)C(=O)N(C)C1=O

Synonyms:

• 1-Butyl-1,2,3,4-tetrahydro-3-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride
• Pyrido[2,3-d]pyrimidine-6-sulfonyl chloride, 1-butyl-1,2,3,4-tetrahydro-3-methyl-2,4-dioxo-