
CAS 1334146-09-6
:2-Piperidinecarbothioamide
Description:
2-Piperidinecarbothioamide, identified by its CAS number 1334146-09-6, is a chemical compound characterized by the presence of a piperidine ring and a carbothioamide functional group. This compound typically exhibits properties associated with both amides and thiols, which may influence its reactivity and interactions in various chemical environments. The piperidine ring contributes to its cyclic structure, providing stability and potential for various substitutions. As a carbothioamide, it contains a sulfur atom bonded to a carbonyl group, which can participate in nucleophilic reactions and may exhibit biological activity. The compound's solubility, melting point, and other physical properties can vary based on its specific structure and purity. In the context of medicinal chemistry, compounds with similar structures are often investigated for their potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Overall, 2-Piperidinecarbothioamide represents a class of compounds that may have significant applications in organic synthesis and drug development.
Formula:C6H12N2S
InChI:InChI=1S/C6H12N2S/c7-6(9)5-3-1-2-4-8-5/h5,8H,1-4H2,(H2,7,9)
InChI key:InChIKey=HBYDKQYZBZQJGL-UHFFFAOYSA-N
SMILES:C(N)(=S)C1CCCCN1
Synonyms:- 2-Piperidinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.