
CAS 1334146-12-1
:1-Aminocyclopentanecarbothioamide
Description:
1-Aminocyclopentanecarbothioamide is an organic compound characterized by the presence of an amino group and a thioamide functional group attached to a cyclopentane ring. This compound features a five-membered carbon ring, which contributes to its cyclic structure, and the thioamide group, which consists of a carbonyl carbon bonded to a sulfur atom and an amine, imparts unique reactivity and properties. The presence of the amino group allows for potential hydrogen bonding, influencing its solubility and interaction with other molecules. As a thioamide, it may exhibit different chemical behavior compared to traditional amides, particularly in nucleophilic reactions. The compound's structural features suggest potential applications in medicinal chemistry and materials science, where thioamides can serve as intermediates or active pharmaceutical ingredients. Additionally, its specific stereochemistry and functional groups may affect its biological activity and reactivity, making it a subject of interest for further research in various chemical and pharmaceutical contexts.
Formula:C6H12N2S
InChI:InChI=1S/C6H12N2S/c7-5(9)6(8)3-1-2-4-6/h1-4,8H2,(H2,7,9)
InChI key:InChIKey=JQMJLBHRSIEGIH-UHFFFAOYSA-N
SMILES:C(N)(=S)C1(N)CCCC1
Synonyms:- Cyclopentanecarbothioamide, 1-amino-
- 1-Aminocyclopentanecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.