CymitQuimica logo

CAS 1334146-21-2

:

1-[(2,2-Difluoroethenyl)oxy]-3,3-dimethyl-2-butanone

Description:
1-[(2,2-Difluoroethenyl)oxy]-3,3-dimethyl-2-butanone is an organic compound characterized by its unique structure, which includes a difluoroethenyl group and a ketone functional group. This compound features a butanone backbone, indicating the presence of a carbonyl group (C=O) within a four-carbon chain, specifically at the second position. The difluoroethenyl moiety contributes to its reactivity and potential applications in various chemical processes. The presence of fluorine atoms often enhances the compound's stability and lipophilicity, making it of interest in fields such as pharmaceuticals and agrochemicals. Additionally, the bulky dimethyl groups provide steric hindrance, which can influence the compound's reactivity and interaction with biological systems. As with many fluorinated compounds, it may exhibit unique physical properties, such as altered boiling and melting points compared to its non-fluorinated analogs. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated organic compounds.
Formula:C8H12F2O2
InChI:InChI=1S/C8H12F2O2/c1-8(2,3)6(11)4-12-5-7(9)10/h5H,4H2,1-3H3
InChI key:InChIKey=DHZRWYWGMLZNBE-UHFFFAOYSA-N
SMILES:C(COC=C(F)F)(C(C)(C)C)=O
Synonyms:
  • 2-Butanone, 1-[(2,2-difluoroethenyl)oxy]-3,3-dimethyl-
  • 1-[(2,2-Difluoroethenyl)oxy]-3,3-dimethyl-2-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.