
CAS 1334146-33-6
:6-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[3.1.1]heptane-3-carboxylic acid
Description:
6-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[3.1.1]heptane-3-carboxylic acid, with the CAS number 1334146-33-6, is a synthetic organic compound characterized by its bicyclic structure, which features a bicyclo[3.1.1]heptane framework. This compound contains multiple functional groups, including an amino group and carboxylic acid, which contribute to its reactivity and potential biological activity. The presence of the dimethylethoxycarbonyl group suggests that it may be used as a protecting group in organic synthesis, particularly in peptide chemistry. The bicyclic nature of the molecule may impart unique steric and electronic properties, influencing its interactions in biological systems. Additionally, the compound's solubility and stability can be affected by the substituents on the bicyclic core. Overall, this compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules, although specific biological activities or applications would require further investigation.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-13(2,3)18-12(17)14-10-7-4-8(10)6-9(5-7)11(15)16/h7-10H,4-6H2,1-3H3,(H,14,17)(H,15,16)
InChI key:InChIKey=BFGJDSWUDVHIFL-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1C2CC1CC(C(O)=O)C2
Synonyms:- Bicyclo[3.1.1]heptane-3-carboxylic acid, 6-[[(1,1-dimethylethoxy)carbonyl]amino]-
- 6-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[3.1.1]heptane-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.