CAS 1334146-52-9

8-Azabicyclo[3.2.1]octan-3-amine, 8-(methylsulfonyl)-, hydrochloride (1:1)

Description:

8-Azabicyclo[3.2.1]octan-3-amine, 8-(methylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as a bicyclic amine. The presence of a methylsulfonyl group enhances its solubility and may influence its biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound's molecular structure suggests potential interactions with biological systems, particularly in the context of neurotransmitter modulation or receptor binding. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound may have implications in medicinal chemistry and pharmacology, warranting further investigation into its therapeutic potential.

Formula: C₈H₁₆N₂O₂S·ClH

InChI: InChI=1S/C8H16N2O2S.ClH/c1-13(11,12)10-7-2-3-8(10)5-6(9)4-7;/h6-8H,2-5,9H2,1H3;1H

InChI key: InChIKey=OLCNWVNLNNJBOM-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)N1C2CC(N)CC1CC2.Cl

Synonyms:

• 8-Azabicyclo[3.2.1]octan-3-amine, 8-(methylsulfonyl)-, hydrochloride (1:1)