
CAS 1334146-53-0
:1,1-Dimethylethyl 5-(1-aminoethyl)-2-azabicyclo[2.1.1]hexane-2-carboxylate
Description:
1,1-Dimethylethyl 5-(1-aminoethyl)-2-azabicyclo[2.1.1]hexane-2-carboxylate, with the CAS number 1334146-53-0, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, indicating it is a bicyclic amine. The presence of the dimethyl group suggests steric hindrance, which can influence its reactivity and interaction with biological systems. The aminoethyl side chain contributes to its potential as a ligand or substrate in various chemical reactions, particularly in medicinal chemistry. The carboxylate functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. This compound may have implications in pharmacology due to its structural features, which could interact with biological targets. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they are not universally defined and can vary based on environmental conditions.
Formula:C12H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-7(13)10-8-5-9(10)14(6-8)11(15)16-12(2,3)4/h7-10H,5-6,13H2,1-4H3
InChI key:InChIKey=JOEKPRNHOMRKCO-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2C(C(C)N)C(C2)C1
Synonyms:- 2-Azabicyclo[2.1.1]hexane-2-carboxylic acid, 5-(1-aminoethyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 5-(1-aminoethyl)-2-azabicyclo[2.1.1]hexane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.