CymitQuimica logo

CAS 1334146-66-5

:

1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-[1,2,3,4-tetrahydro-2-(2-pyridinylmethyl)-5-isoquinolinyl]-, hydrochloride (1:2)

Description:
1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-[1,2,3,4-tetrahydro-2-(2-pyridinylmethyl)-5-isoquinolinyl]-, hydrochloride (1:2) is a complex organic compound characterized by its triazole ring, which contributes to its potential biological activity. The presence of the carboxylic acid functional group indicates acidic properties, while the methyl group and the isoquinoline structure suggest potential for various interactions in biological systems. This compound is likely to exhibit solubility in polar solvents due to the presence of the hydrochloride salt form, enhancing its stability and bioavailability. The triazole moiety is known for its role in medicinal chemistry, particularly in antifungal and antimicrobial agents. Additionally, the pyridine and isoquinoline components may impart unique pharmacological properties, making this compound of interest in drug development. Its specific interactions, reactivity, and applications would depend on further studies, including its synthesis, characterization, and biological evaluation. Overall, this compound represents a significant area of research in medicinal chemistry and pharmacology.
Formula:C19H19N5O2·2ClH
InChI:InChI=1S/C19H19N5O2.2ClH/c1-13-18(19(25)26)21-22-24(13)17-7-4-5-14-11-23(10-8-16(14)17)12-15-6-2-3-9-20-15;;/h2-7,9H,8,10-12H2,1H3,(H,25,26);2*1H
InChI key:InChIKey=CZMIOQIOHKTXQW-UHFFFAOYSA-N
SMILES:CC=1N(C2=C3C(CN(CC4=CC=CC=N4)CC3)=CC=C2)N=NC1C(O)=O.Cl
Synonyms:
  • 1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-[1,2,3,4-tetrahydro-2-(2-pyridinylmethyl)-5-isoquinolinyl]-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.