CAS 1334146-71-2

Thiomorpholine, 2-methyl-, 1-oxide

Description:

Thiomorpholine, 2-methyl-, 1-oxide, identified by its CAS number 1334146-71-2, is a heterocyclic organic compound characterized by a thiomorpholine ring structure with a methyl group and an oxide functional group. This compound features a six-membered ring containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of the methyl group enhances its lipophilicity, potentially influencing its solubility and reactivity. As an oxide, it may exhibit properties associated with oxidation states, affecting its behavior in chemical reactions. Thiomorpholine derivatives are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. The compound's stability, reactivity, and interaction with other substances can vary based on environmental conditions such as temperature and pH. Overall, thiomorpholine, 2-methyl-, 1-oxide represents a class of compounds with diverse applications, particularly in medicinal chemistry and material science, due to its structural characteristics and functional versatility.

Formula: C₅H₁₁NOS

InChI: InChI=1S/C5H11NOS/c1-5-4-6-2-3-8(5)7/h5-6H,2-4H2,1H3

InChI key: InChIKey=SYXJWCCFFUMDRG-UHFFFAOYSA-N

SMILES: CC1S(=O)CCNC1

Synonyms:

• Thiomorpholine, 2-methyl-, 1-oxide

2-​Methyl-thiomorpholine 1-​oxide

CAS: 1334146-71-2

Versatile small molecule scaffold

Formula: C₅H₁₁NOS

Purity: Min. 95%

Molecular weight: 133.21 g/mol

Ref: 3D-JDC14671