CAS 1334146-72-3

6-Azaspiro[2.5]octane-1,6-dicarboxylic acid, 6-(1,1-dimethylethyl) ester, 1-hydrazide

Description:

6-Azaspiro[2.5]octane-1,6-dicarboxylic acid, 6-(1,1-dimethylethyl) ester, 1-hydrazide is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both azaspiro and hydrazide functionalities. The presence of the azaspiro moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The dicarboxylic acid component indicates that the compound can participate in various chemical reactions, including esterification and amidation, which may enhance its reactivity and versatility. The tert-butyl ester group contributes to the compound's lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the hydrazide functional group may exhibit biological activity, making it a candidate for further investigation in drug design. Overall, this compound's structural features suggest it could be of interest in synthetic organic chemistry and pharmacology, although specific biological activities and applications would require further research and characterization.

Formula: C₁₃H₂₃N₃O₃

InChI: InChI=1S/C13H23N3O3/c1-12(2,3)19-11(18)16-6-4-13(5-7-16)8-9(13)10(17)15-14/h9H,4-8,14H2,1-3H3,(H,15,17)

InChI key: InChIKey=PHSVISKOABVNEO-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1C2(C1)CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 6-Azaspiro[2.5]octane-1,6-dicarboxylic acid, 6-(1,1-dimethylethyl) ester, 1-hydrazide

tert-Butyl 1-(hydrazinecarbonyl)-6-azaspiro[2.5]octane-6-carboxylate

CAS: 1334146-72-3

Versatile small molecule scaffold

Formula: C₁₃H₂₃N₃O₃

Purity: Min. 95%

Molecular weight: 269.34 g/mol

Ref: 3D-JDC14672