CAS 1334146-83-6

2-[(4-Acetyl-3-fluorophenyl)thio]acetic acid

Description:

2-[(4-Acetyl-3-fluorophenyl)thio]acetic acid is an organic compound characterized by the presence of a thioether functional group and an acetic acid moiety. The structure features a fluorinated aromatic ring, which can influence its reactivity and biological activity due to the electronegative fluorine atom. The acetyl group contributes to the compound's overall polarity and can participate in various chemical reactions, such as acylation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the presence of the thioether and the acetyl group, which may also affect its interactions with biological targets. Additionally, the compound's molecular weight and specific functional groups suggest potential applications in drug development or as a synthetic intermediate in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.

Formula: C₁₀H₉FO₃S

InChI: InChI=1S/C10H9FO3S/c1-6(12)8-3-2-7(4-9(8)11)15-5-10(13)14/h2-4H,5H2,1H3,(H,13,14)

InChI key: InChIKey=PEPMALGUUYDTSS-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(F)C=C(SCC(O)=O)C=C1

Synonyms:

• 2-[(4-Acetyl-3-fluorophenyl)thio]acetic acid
• Acetic acid, 2-[(4-acetyl-3-fluorophenyl)thio]-

2-[(4-Acetyl-3-fluorophenyl)sulfanyl]acetic acid

CAS: 1334146-83-6

Versatile small molecule scaffold

Formula: C₁₀H₉FO₃S

Purity: Min. 95%

Molecular weight: 228.24 g/mol

Ref: 3D-JDC14683