CAS 1334146-90-5

1-(1-Ethylpropyl)-1H-1,2,4-triazole-3,5-diamine

Description:

1-(1-Ethylpropyl)-1H-1,2,4-triazole-3,5-diamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethylpropyl substituent, contributing to its unique properties and potential applications. The presence of amino groups at the 3 and 5 positions of the triazole ring enhances its reactivity and solubility in various solvents, making it suitable for diverse chemical reactions. It may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of agrochemicals or antifungal agents. The compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and the environment in which it is used. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₇H₁₅N₅

InChI: InChI=1S/C7H15N5/c1-3-5(4-2)12-7(9)10-6(8)11-12/h5H,3-4H2,1-2H3,(H4,8,9,10,11)

InChI key: InChIKey=PXOOVPSPIDSEJG-UHFFFAOYSA-N

SMILES: C(CC)(CC)N1N=C(N)N=C1N

Synonyms:

• 1-(1-Ethylpropyl)-1H-1,2,4-triazole-3,5-diamine
• 1H-1,2,4-Triazole-3,5-diamine, 1-(1-ethylpropyl)-