CAS 1334146-94-9

2-(1-Ethoxyethyl)-4-methyl-5-thiazolecarboxylic acid

Description:

2-(1-Ethoxyethyl)-4-methyl-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethoxyethyl group, contributing to its solubility and potential reactivity. The presence of a carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may act as a weak acid. The methyl group at the 4-position of the thiazole ring can influence its biological activity and steric properties. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and behavior in biological systems would depend on its interactions with other molecules, including enzymes and receptors. As with many thiazole derivatives, it may also possess antimicrobial or antifungal properties, although detailed studies would be necessary to confirm such activities. Overall, the unique structural features of this compound suggest potential utility in various chemical and pharmaceutical applications.

Formula: C₉H₁₃NO₃S

InChI: InChI=1S/C9H13NO3S/c1-4-13-6(3)8-10-5(2)7(14-8)9(11)12/h6H,4H2,1-3H3,(H,11,12)

InChI key: InChIKey=VHHNAKXPUMJMLP-UHFFFAOYSA-N

SMILES: C(OCC)(C)C=1SC(C(O)=O)=C(C)N1

Synonyms:

• 5-Thiazolecarboxylic acid, 2-(1-ethoxyethyl)-4-methyl-
• 2-(1-Ethoxyethyl)-4-methyl-5-thiazolecarboxylic acid

2-(1-Ethoxyethyl)-4-methyl-1,3-thiazole-5-carboxylic acid

CAS: 1334146-94-9

Versatile small molecule scaffold

Formula: C₉H₁₃NO₃S

Purity: Min. 95%

Molecular weight: 215.27 g/mol

Ref: 3D-JDC14694