CymitQuimica logo

CAS 1334146-95-0

:

α-Amino-4-fluorobenzeneethanethioamide

Description:
α-Amino-4-fluorobenzeneethanethioamide is an organic compound characterized by the presence of an amino group, a fluorobenzene ring, and a thioamide functional group. The structure features a fluorine atom substituted at the para position of the benzene ring, which can influence the compound's reactivity and polarity. The thioamide group, characterized by the presence of a sulfur atom double-bonded to a carbon atom and single-bonded to a nitrogen atom, imparts unique chemical properties, including potential for hydrogen bonding and reactivity in nucleophilic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and interaction with biological systems can be influenced by the presence of the fluorine atom and the thioamide moiety. Overall, α-Amino-4-fluorobenzeneethanethioamide represents a versatile structure that can be explored for various applications in synthetic chemistry and pharmacology.
Formula:C8H9FN2S
InChI:InChI=1S/C8H9FN2S/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H2,11,12)
InChI key:InChIKey=OHWCJIJJVJFKEU-UHFFFAOYSA-N
SMILES:C(C(N)=S)(N)C1=CC=C(F)C=C1
Synonyms:
  • Benzeneethanethioamide, α-amino-4-fluoro-
  • α-Amino-4-fluorobenzeneethanethioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.