CAS 1334147-02-2

N-[2-(4-Methyl-2-thiazolyl)ethyl]urea

Description:

N-[2-(4-Methyl-2-thiazolyl)ethyl]urea, identified by its CAS number 1334147-02-2, is a chemical compound that features a urea functional group linked to a thiazole derivative. This compound typically exhibits characteristics common to urea derivatives, such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of the urea moiety. The thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The methyl group on the thiazole enhances its lipophilicity, which may influence its interaction with biological targets. Additionally, the compound may exhibit specific reactivity patterns typical of both urea and thiazole functionalities, making it of interest in medicinal chemistry and material science. Its precise applications and behavior would depend on further studies, including its stability, reactivity, and potential biological effects.

Formula: C₇H₁₁N₃OS

InChI: InChI=1S/C7H11N3OS/c1-5-4-12-6(10-5)2-3-9-7(8)11/h4H,2-3H2,1H3,(H3,8,9,11)

InChI key: InChIKey=AJFGEQMDZWBTPD-UHFFFAOYSA-N

SMILES: C(CNC(N)=O)C=1SC=C(C)N1

Synonyms:

• Urea, N-[2-(4-methyl-2-thiazolyl)ethyl]-
• N-[2-(4-Methyl-2-thiazolyl)ethyl]urea

[2-(4-Methyl-1,3-thiazol-2-yl)ethyl]urea

CAS: 1334147-02-2

Versatile small molecule scaffold

Formula: C₇H₁₁N₃OS

Purity: Min. 95%

Molecular weight: 185.25 g/mol

Ref: 3D-JDC14702