
CAS 1334147-03-3
:N-(3-Amino-1H-1,2,4-triazol-5-yl)propanamide
Description:
N-(3-Amino-1H-1,2,4-triazol-5-yl)propanamide is a chemical compound characterized by its unique triazole ring structure, which contributes to its biological activity. The presence of an amino group and a propanamide moiety enhances its solubility and reactivity. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of antifungal agents and other therapeutic agents due to its ability to interact with biological targets. Its molecular structure allows for hydrogen bonding, which can influence its interaction with enzymes and receptors. Additionally, the triazole ring is known for its stability and ability to form coordination complexes with metal ions, making it of interest in coordination chemistry. The compound's properties, such as melting point, solubility, and reactivity, can vary based on its environment and the presence of other functional groups. Overall, N-(3-Amino-1H-1,2,4-triazol-5-yl)propanamide represents a significant area of research in medicinal chemistry and material science.
Formula:C5H9N5O
InChI:InChI=1S/C5H9N5O/c1-2-3(11)7-5-8-4(6)9-10-5/h2H2,1H3,(H4,6,7,8,9,10,11)
InChI key:InChIKey=FHAHVVGYLTXXQC-UHFFFAOYSA-N
SMILES:N(C(CC)=O)C=1NC(N)=NN1
Synonyms:- N-(3-Amino-1H-1,2,4-triazol-5-yl)propanamide
- Propanamide, N-(3-amino-1H-1,2,4-triazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.