
CAS 1334147-06-6
:4-(Methylsulfinyl)cyclohexanamine
Description:
4-(Methylsulfinyl)cyclohexanamine, identified by its CAS number 1334147-06-6, is an organic compound characterized by the presence of a cyclohexane ring substituted with an amine group and a methylsulfinyl group. This compound features a six-membered carbon ring, which contributes to its cyclic structure, while the amine group introduces basic properties and potential for hydrogen bonding. The methylsulfinyl group, derived from methylsulfide, imparts unique electronic and steric characteristics, influencing the compound's reactivity and solubility. Typically, such compounds may exhibit biological activity, making them of interest in pharmaceutical research. The presence of sulfur in the structure can also affect the compound's stability and interaction with other molecules. Overall, 4-(Methylsulfinyl)cyclohexanamine is a noteworthy compound in the realm of organic chemistry, particularly for its potential applications in medicinal chemistry and material science. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C7H15NOS
InChI:InChI=1S/C7H15NOS/c1-10(9)7-4-2-6(8)3-5-7/h6-7H,2-5,8H2,1H3
InChI key:InChIKey=HCDTYFARZOZWND-UHFFFAOYSA-N
SMILES:S(C)(=O)C1CCC(N)CC1
Synonyms:- Cyclohexanamine, 4-(methylsulfinyl)-
- 4-(Methylsulfinyl)cyclohexanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.