
CAS 1334147-09-9
:Benzamide, 4-amino-N-1-azabicyclo[2.2.2]oct-3-yl-, hydrochloride (1:2)
Description:
Benzamide, 4-amino-N-1-azabicyclo[2.2.2]oct-3-yl-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates a nitrogen atom within a bicyclo[2.2.2]octane framework. This compound features an amide functional group, contributing to its potential biological activity. The presence of the amino group enhances its solubility and reactivity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its specific interactions and mechanisms of action would depend on its structural conformation and the presence of functional groups. Overall, this compound represents a class of substances that may have implications in drug development and therapeutic applications, although detailed studies would be necessary to elucidate its full profile and potential uses.
Formula:C14H19N3O·2ClH
InChI:InChI=1S/C14H19N3O.2ClH/c15-12-3-1-11(2-4-12)14(18)16-13-9-17-7-5-10(13)6-8-17;;/h1-4,10,13H,5-9,15H2,(H,16,18);2*1H
InChI key:InChIKey=DUGTUNDFHALGOT-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=C(N)C=C1)C2C3CCN(C2)CC3.Cl
Synonyms:- Benzamide, 4-amino-N-1-azabicyclo[2.2.2]oct-3-yl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.