CymitQuimica logo

CAS 1334147-72-6

:

8-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[3.2.1]octane-3-carboxylic acid

Description:
8-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[3.2.1]octane-3-carboxylic acid is a bicyclic compound characterized by its unique structural features, including a bicyclo[3.2.1]octane framework and multiple functional groups. The presence of an amino group and carboxylic acid functionality suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including peptide synthesis or as a building block in medicinal chemistry. The dimethylethoxycarbonyl group serves as a protective or modifying group, influencing the compound's solubility and stability. This compound may exhibit interesting biological activities due to its structural complexity and functional groups, which could interact with biological targets. Its CAS number, 1334147-72-6, allows for precise identification in chemical databases, facilitating research and development. Overall, this compound's unique bicyclic structure and functional groups make it a subject of interest in organic synthesis and pharmaceutical applications.
Formula:C14H23NO4
InChI:InChI=1S/C14H23NO4/c1-14(2,3)19-13(18)15-11-8-4-5-9(11)7-10(6-8)12(16)17/h8-11H,4-7H2,1-3H3,(H,15,18)(H,16,17)
InChI key:InChIKey=WANSNGFRLUNMIS-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1C2CC(C(O)=O)CC1CC2
Synonyms:
  • 8-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[3.2.1]octane-3-carboxylic acid
  • Bicyclo[3.2.1]octane-3-carboxylic acid, 8-[[(1,1-dimethylethoxy)carbonyl]amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.