
CAS 1334147-89-5
:8-Chloro-3-iodo-5-quinolinesulfonamide
Description:
8-Chloro-3-iodo-5-quinolinesulfonamide is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with chlorine and iodine atoms, as well as a sulfonamide functional group. This compound is typically recognized for its potential biological activity, particularly in medicinal chemistry, where it may exhibit antimicrobial or antitumor properties. The presence of halogen substituents, such as chlorine and iodine, can influence the compound's reactivity and interaction with biological targets. Additionally, the sulfonamide group is known for its role in various pharmacological applications, often contributing to the compound's solubility and stability. The molecular structure of 8-Chloro-3-iodo-5-quinolinesulfonamide allows for potential interactions with enzymes or receptors, making it a subject of interest in drug development. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, and its use should be guided by appropriate regulatory standards.
Formula:C9H6ClIN2O2S
InChI:InChI=1S/C9H6ClIN2O2S/c10-7-1-2-8(16(12,14)15)6-3-5(11)4-13-9(6)7/h1-4H,(H2,12,14,15)
InChI key:InChIKey=PLXPYEJZZGVTOU-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C2=C(C(Cl)=CC1)N=CC(I)=C2
Synonyms:- 5-Quinolinesulfonamide, 8-chloro-3-iodo-
- 8-Chloro-3-iodo-5-quinolinesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.