CymitQuimica logo

CAS 1334148-20-7

:

α,α,3-Trifluorobenzeneethanethioamide

Description:
α,α,3-Trifluorobenzeneethanethioamide is a chemical compound characterized by the presence of a trifluoromethyl group attached to a benzene ring, along with an ethanethioamide functional group. This compound features a benzene ring substituted with three fluorine atoms at the alpha position, which significantly influences its chemical reactivity and physical properties. The presence of the thioamide group introduces sulfur into the molecular structure, which can enhance its potential for forming hydrogen bonds and participating in various chemical reactions. The trifluoromethyl group is known for imparting unique electronic properties, making the compound potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound's molecular structure suggests it may exhibit distinct solubility characteristics and stability under different conditions. As with many fluorinated compounds, α,α,3-Trifluorobenzeneethanethioamide may also exhibit low volatility and high thermal stability, making it of interest in materials science and chemical synthesis.
Formula:C8H6F3NS
InChI:InChI=1S/C8H6F3NS/c9-6-3-1-2-5(4-6)8(10,11)7(12)13/h1-4H,(H2,12,13)
InChI key:InChIKey=OMJZSGCVSYJLKG-UHFFFAOYSA-N
SMILES:C(C(N)=S)(F)(F)C1=CC(F)=CC=C1
Synonyms:
  • α,α,3-Trifluorobenzeneethanethioamide
  • Benzeneethanethioamide, α,α,3-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.