CAS 1334148-38-7

Methanone, (6-amino-2-pyridinyl)[2-(hydroxymethyl)-1-pyrrolidinyl]-, hydrochloride (1:1)

Description:

Methanone, (6-amino-2-pyridinyl)[2-(hydroxymethyl)-1-pyrrolidinyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyridine ring and a pyrrolidine moiety. The presence of an amino group at the 6-position of the pyridine ring contributes to its basicity and potential for forming hydrogen bonds. The hydroxymethyl group attached to the pyrrolidine enhances its solubility in polar solvents and may participate in various chemical interactions. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its molecular interactions and pharmacological properties would depend on the specific functional groups and their spatial arrangement, influencing its reactivity and potential applications in medicinal chemistry. Safety and handling precautions should be observed due to its classification and potential biological effects.

Formula: C₁₁H₁₅N₃O₂·ClH

InChI: InChI=1S/C11H15N3O2.ClH/c12-10-5-1-4-9(13-10)11(16)14-6-2-3-8(14)7-15;/h1,4-5,8,15H,2-3,6-7H2,(H2,12,13);1H

InChI key: InChIKey=LOENCABBJKXETQ-UHFFFAOYSA-N

SMILES: C(=O)(N1C(CO)CCC1)C=2N=C(N)C=CC2.Cl

Synonyms:

• Methanone, (6-amino-2-pyridinyl)[2-(hydroxymethyl)-1-pyrrolidinyl]-, hydrochloride (1:1)

[1-(6-Aminopyridine-2-carbonyl)pyrrolidin-2-yl]methanol hydrochloride

CAS: 1334148-38-7

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 257.72 g/mol

Ref: 3D-JDC14838