CAS 1334148-39-8

Cycloheptanamine, 1-[5-(azidomethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

Description:

Cycloheptanamine, 1-[5-(azidomethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and an oxadiazole moiety. The presence of the azidomethyl group introduces notable reactivity, particularly in click chemistry applications, making it a potential candidate for various synthetic pathways. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in biological and chemical applications. The compound may exhibit biological activity due to the presence of the oxadiazole ring, which is known for its pharmacological properties. Additionally, the azide functional group can facilitate further functionalization, allowing for the development of more complex molecules. Safety and handling precautions are essential due to the potential hazards associated with azides, which can be explosive under certain conditions. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₁₀H₁₆N₆O·ClH

InChI: InChI=1S/C10H16N6O.ClH/c11-10(5-3-1-2-4-6-10)9-14-8(17-15-9)7-13-16-12;/h1-7,11H2;1H

InChI key: InChIKey=RQXRBXCIVCNKMV-UHFFFAOYSA-N

SMILES: NC1(CCCCCC1)C=2N=C(CN=[N+]=[N-])ON2.Cl

Synonyms:

• Cycloheptanamine, 1-[5-(azidomethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)