CAS 1334148-69-4

Octahydro-1H-isoindole-4-carboxylic acid

Description:

Octahydro-1H-isoindole-4-carboxylic acid is a bicyclic organic compound characterized by its unique structure, which includes a saturated isoindole framework. This compound features a carboxylic acid functional group, contributing to its acidic properties. Typically, it appears as a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. The presence of the carboxylic acid group allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. Octahydro-1H-isoindole-4-carboxylic acid is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. Its structural characteristics may also allow for modifications that can enhance its pharmacological properties. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, this compound represents a versatile scaffold for further chemical exploration and application in synthetic chemistry and pharmacology.

Formula: C₉H₁₅NO₂

InChI: InChI=1S/C9H15NO2/c11-9(12)7-3-1-2-6-4-10-5-8(6)7/h6-8,10H,1-5H2,(H,11,12)

InChI key: InChIKey=GZFWSYRJRFBXPZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2C(CNC2)CCC1

Synonyms:

• Octahydro-1H-isoindole-4-carboxylic acid
• 1H-Isoindole-4-carboxylic acid, octahydro-