CAS 1334148-78-5

Benzeneethanamine, α-cyclopropyl-, hydrochloride (1:1)

Description:

Benzeneethanamine, α-cyclopropyl-, hydrochloride (1:1), also known by its CAS number 1334148-78-5, is a chemical compound characterized by its amine functional group and a cyclopropyl substituent on the ethyl chain. This compound typically appears as a white to off-white crystalline solid, indicating its hydrochloride salt form, which enhances its solubility in water. The presence of the benzene ring contributes to its aromatic properties, while the cyclopropyl group can influence its reactivity and steric properties. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₁H₁₅N·ClH

InChI: InChI=1S/C11H15N.ClH/c12-11(10-6-7-10)8-9-4-2-1-3-5-9;/h1-5,10-11H,6-8,12H2;1H

InChI key: InChIKey=SGVSCQQPZCEEEZ-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(N)C2CC2.Cl

Synonyms:

• Benzeneethanamine, α-cyclopropyl-, hydrochloride (1:1)

1-Cyclopropyl-2-phenylethan-1-amine hydrochloride

Controlled Product

CAS: 1334148-78-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN

Purity: Min. 95%

Molecular weight: 197.7 g/mol

Ref: 3D-JDC14878