
CAS 1334148-79-6
:1,2,3,4-Tetrahydro-3-methyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-sulfonyl chloride
Description:
1,2,3,4-Tetrahydro-3-methyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-sulfonyl chloride is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The presence of the dioxo groups contributes to its potential as a versatile building block in organic synthesis, particularly in medicinal chemistry. The tetrahydro configuration indicates that the compound is saturated in certain positions, which may influence its solubility and reactivity. Additionally, the methyl and propyl substituents can affect the compound's steric and electronic properties, potentially enhancing its biological activity. As a sulfonyl chloride, it is likely to be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, this compound's structural features suggest it may have applications in drug development or as an intermediate in the synthesis of more complex molecules.
Formula:C11H12ClN3O4S
InChI:InChI=1S/C11H12ClN3O4S/c1-3-4-15-9-8(10(16)14(2)11(15)17)5-7(6-13-9)20(12,18)19/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=GTDFCKZZZXZDAC-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(=CC(S(Cl)(=O)=O)=CN2)C(=O)N(C)C1=O
Synonyms:- Pyrido[2,3-d]pyrimidine-6-sulfonyl chloride, 1,2,3,4-tetrahydro-3-methyl-2,4-dioxo-1-propyl-
- 1,2,3,4-Tetrahydro-3-methyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.