
CAS 1334148-98-9
:1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-[1,2,3,4-tetrahydro-2-(2-pyridinylmethyl)-5-isoquinolinyl]-, hydrochloride (1:1)
Description:
1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-[1,2,3,4-tetrahydro-2-(2-pyridinylmethyl)-5-isoquinolinyl]-, hydrochloride (1:1) is a complex organic compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical environments. The presence of a methyl group and a tetrahydroisoquinoline moiety indicates that it may exhibit interesting biological activities, possibly related to its interactions with biological targets. The hydrochloride form suggests that the compound is a salt, which can enhance its solubility in aqueous solutions, making it suitable for pharmaceutical applications. The specific arrangement of substituents, including the pyridine moiety, may influence its pharmacokinetic properties, such as absorption and distribution. Overall, this compound's unique structural features and functional groups suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C19H19N5O2·ClH
InChI:InChI=1S/C19H19N5O2.ClH/c1-13-18(19(25)26)21-22-24(13)17-7-4-5-14-11-23(10-8-16(14)17)12-15-6-2-3-9-20-15;/h2-7,9H,8,10-12H2,1H3,(H,25,26);1H
InChI key:InChIKey=ODYDXEJKQZJLHL-UHFFFAOYSA-N
SMILES:CC=1N(C2=C3C(CN(CC4=CC=CC=N4)CC3)=CC=C2)N=NC1C(O)=O.Cl
Synonyms:- 1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-[1,2,3,4-tetrahydro-2-(2-pyridinylmethyl)-5-isoquinolinyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.