CAS 1334149-01-7

3H-Imidazo[4,5-b]pyridine, 6-bromo-2-(chloromethyl)-, hydrochloride (1:1)

Description:

3H-Imidazo[4,5-b]pyridine, 6-bromo-2-(chloromethyl)-, hydrochloride (1:1) is a heterocyclic compound characterized by its imidazo[4,5-b]pyridine core, which features a fused bicyclic structure containing nitrogen atoms. The presence of a bromine atom at the 6-position and a chloromethyl group at the 2-position contributes to its reactivity and potential applications in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit biological activity, making it of interest in drug discovery and development. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. The CAS number 1334149-01-7 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Safety data and handling precautions should be considered, as halogenated compounds can pose risks in terms of toxicity and environmental impact. Overall, this compound represents a valuable scaffold for further research in the field of organic and medicinal chemistry.

Formula: C₇H₅BrClN₃·ClH

InChI: InChI=1S/C7H5BrClN3.ClH/c8-4-1-5-7(10-3-4)12-6(2-9)11-5;/h1,3H,2H2,(H,10,11,12);1H

InChI key: InChIKey=DCFOVWBVMOJBFL-UHFFFAOYSA-N

SMILES: C(Cl)C1=NC=2C(N1)=CC(Br)=CN2.Cl

Synonyms:

• 3H-Imidazo[4,5-b]pyridine, 6-bromo-2-(chloromethyl)-, hydrochloride (1:1)

6-Bromo-2-(chloromethyl)-3H-imidazo[4,5-b]pyridine hydrochloride

CAS: 1334149-01-7

Versatile small molecule scaffold

Formula: C₇H₆BrCl₂N₃

Purity: Min. 95%

Molecular weight: 282.95 g/mol

Ref: 3D-JDC14901