CAS 1334149-17-5: Tetrahydro-2-phenyl-3-furanmethanamine

Description:Tetrahydro-2-phenyl-3-furanmethanamine is a chemical compound characterized by its unique structure, which includes a tetrahydrofuran ring fused with a phenyl group and an amine functional group. This compound is typically classified as an amine due to the presence of the amine (-NH2) group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The furan ring contributes to the compound's aromatic properties, potentially influencing its reactivity and interaction with other molecules. Tetrahydro-2-phenyl-3-furanmethanamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's molecular weight and structural features may affect its pharmacokinetics and pharmacodynamics if used in pharmaceutical applications. As with any chemical substance, safety data and handling precautions should be considered, especially in laboratory or industrial settings.

Formula:C₁₁H₁₅NO

InChI:InChI=1S/C11H15NO/c12-8-10-6-7-13-11(10)9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2

InChI key:InChIKey=YGPJNIXEJJPHPZ-UHFFFAOYSA-N

SMILES:O1CCC(CN)C1C=2C=CC=CC2