CAS 1334160-81-4

(αR)-α-Methyl-5-phenyl-2-oxazolemethanamine

Description:

(αR)-α-Methyl-5-phenyl-2-oxazolemethanamine is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methyl group and a phenyl group, contributing to its unique properties and potential biological activity. The presence of the oxazole moiety suggests that it may exhibit interesting pharmacological effects, possibly acting as a ligand for various biological targets. The specific stereochemistry indicated by the (αR) designation implies that the compound has a particular spatial arrangement, which can significantly influence its reactivity and interaction with biological systems. Additionally, the amine functional group suggests potential for hydrogen bonding and reactivity in various chemical environments. Overall, this compound may be of interest in medicinal chemistry and drug development, although detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1S/C11H12N2O/c1-8(12)11-13-7-10(14-11)9-5-3-2-4-6-9/h2-8H,12H2,1H3/t8-/m1/s1

InChI key: InChIKey=ZMYNPJZRCCAZCT-MRVPVSSYSA-N

SMILES: [C@H](C)(N)C=1OC(=CN1)C2=CC=CC=C2

Synonyms:

• (αR)-α-Methyl-5-phenyl-2-oxazolemethanamine
• 2-Oxazolemethanamine, α-methyl-5-phenyl-, (αR)-