CAS 1334160-83-6

(αS)-2-Chloro-α-methylimidazo[1,2-a]pyridine-3-methanol

Description:

(αS)-2-Chloro-α-methylimidazo[1,2-a]pyridine-3-methanol is a chemical compound characterized by its unique structure, which includes a chloro group and a hydroxymethyl group attached to an imidazo[1,2-a]pyridine framework. This compound is notable for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, as imidazo compounds are often studied for their roles in biological systems and their interactions with DNA. The presence of the chlorine atom and the hydroxymethyl group can influence the compound's reactivity and solubility, affecting its behavior in various chemical environments. Additionally, the stereochemistry indicated by the (αS) designation suggests specific spatial arrangements of atoms that may impact the compound's pharmacological properties. Overall, this substance is of interest in both synthetic chemistry and toxicology, warranting further investigation into its properties and potential applications.

Formula: C₉H₉ClN₂O

InChI: InChI=1S/C9H9ClN2O/c1-6(13)8-9(10)11-7-4-2-3-5-12(7)8/h2-6,13H,1H3/t6-/m0/s1

InChI key: InChIKey=MFKWBQKSSHBRSN-LURJTMIESA-N

SMILES: [C@@H](C)(O)C=1N2C(=NC1Cl)C=CC=C2

Synonyms:

• Imidazo[1,2-a]pyridine-3-methanol, 2-chloro-α-methyl-, (αS)-
• (αS)-2-Chloro-α-methylimidazo[1,2-a]pyridine-3-methanol