
CAS 1334160-88-1
:(3R)-3,4-Diamino-1-butanol
Description:
(3R)-3,4-Diamino-1-butanol is an organic compound characterized by the presence of two amino groups and a hydroxyl group attached to a four-carbon backbone. Its structure features a chiral center at the third carbon, which contributes to its specific stereochemistry, denoted by the (3R) configuration. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydroxyl and amino groups, which can engage in hydrogen bonding. (3R)-3,4-Diamino-1-butanol is of interest in various fields, including pharmaceuticals and biochemistry, as it can serve as a building block for the synthesis of more complex molecules or as a potential therapeutic agent. Its reactivity is influenced by the amino and hydroxyl functional groups, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H12N2O
InChI:InChI=1S/C4H12N2O/c5-3-4(6)1-2-7/h4,7H,1-3,5-6H2/t4-/m1/s1
InChI key:InChIKey=WIYMETYMVDXKRR-SCSAIBSYSA-N
SMILES:[C@@H](CCO)(CN)N
Synonyms:- 1-Butanol, 3,4-diamino-, (3R)-
- (3R)-3,4-Diamino-1-butanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.