CAS 1334169-97-9

Poly(oxy-1,2-ethanediyl), α-(2-aminoethyl)-ω-[3-[2-[(1,1-dimethylethoxy)carbonyl]hydrazinyl]-3-oxopropoxy]-

Description:

Poly(oxy-1,2-ethanediyl), α-(2-aminoethyl)-ω-[3-[2-[(1,1-dimethylethoxy)carbonyl]hydrazinyl]-3-oxopropoxy]- is a complex polymeric compound characterized by its polyether backbone, which is derived from ethylene oxide. This substance features an aminoethyl group that enhances its reactivity and potential for biological applications, particularly in drug delivery and bioconjugation. The presence of a hydrazine moiety suggests potential for forming hydrazone linkages, which are useful in various chemical reactions, including those involving aldehydes and ketones. Additionally, the dimethylethoxycarbonyl group provides steric hindrance and stability, influencing the compound's solubility and reactivity. Overall, this compound exhibits properties typical of polyether-based materials, such as flexibility, biocompatibility, and the ability to form hydrogen bonds, making it suitable for applications in pharmaceuticals and materials science. Its specific characteristics, including molecular weight and thermal stability, would depend on the degree of polymerization and the specific conditions under which it was synthesized.

Formula: C₃₂H₆₅N₃O₁₅

InChI: InChI=1S/C12H25N3O5/c1-12(2,3)20-11(17)15-14-10(16)4-6-18-8-9-19-7-5-13/h4-9,13H2,1-3H3,(H,14,16)(H,15,17)

InChI key: InChIKey=UDVYFYDWDLXHPA-UHFFFAOYSA-N

SMILES: N(NC(CCOCCOCCN)=O)C(OC(C)(C)C)=O

Synonyms:

• Poly(oxy-1,2-ethanediyl), α-(2-aminoethyl)-ω-[3-[2-[(1,1-dimethylethoxy)carbonyl]hydrazinyl]-3-oxopropoxy]-
• Amino-PEG12-N-Boc-hydrazide
• Amino-dPEG-t-boc-hydrazide

Amino-dPEG®12-t-boc-Hydrazide

CAS: 1334169-97-9

Amino-dPEG®12-t-boc-Hydrazide is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Amino-dPEG®12-t-boc-Hydrazide is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₃₂H₆₅N₃O₁₅

Purity: Min. 95%

Molecular weight: 731.87 g/mol

Ref: 3D-DPG-5814