CAS 1334170-02-3
:1,25-Bis(2,5-dioxo-1-pyrrolidinyl) 4,7,10,13,16,19,22-heptaoxapentacosanedioate
Description:
1,25-Bis(2,5-dioxo-1-pyrrolidinyl) 4,7,10,13,16,19,22-heptaoxapentacosanedioate, identified by its CAS number 1334170-02-3, is a complex organic compound characterized by its unique structural features. This substance contains multiple functional groups, including pyrrolidinyl and dioxo moieties, which contribute to its chemical reactivity and potential biological activity. The presence of heptaoxapentacosanedioate indicates a long carbon chain with several ether linkages, suggesting that it may exhibit properties related to solubility and stability in various environments. The compound's intricate structure may allow for interactions with biological systems, making it of interest in pharmaceutical or materials science applications. Its synthesis and characterization would typically involve advanced techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its purity and structural integrity. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of drug design and development.
Formula:C26H40N2O15
InChI:InChI=1S/C26H40N2O15/c29-21-1-2-22(30)27(21)42-25(33)5-7-35-9-11-37-13-15-39-17-19-41-20-18-40-16-14-38-12-10-36-8-6-26(34)43-28-23(31)3-4-24(28)32/h1-20H2
InChI key:InChIKey=QWDCSPQIVZTPRD-UHFFFAOYSA-N
SMILES:O(C(CCOCCOCCOCCOCCOCCOCCOCCC(ON1C(=O)CCC1=O)=O)=O)N2C(=O)CCC2=O
Synonyms:- 4,7,10,13,16,19,22-Heptaoxapentacosanedioic acid, 1,25-bis(2,5-dioxo-1-pyrrolidinyl) ester
- 1,25-Bis(2,5-dioxo-1-pyrrolidinyl) 4,7,10,13,16,19,22-heptaoxapentacosanedioate
- NHS-PEG6-NHS
- α,ω-disuccinimidyl hexaethylene glycol
- Bis-PEG7-NHS ester
- alpha, oMega-DisucciniMidyl hexaethylene glycol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
α, ω-DisucciniMidyl hexaethylene glycol
CAS:Formula:C26H40N2O15Purity:95%Color and Shape:SolidMolecular weight:620.6002Bis-PEG7-NHS ester
CAS:Bis-PEG7-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1].Formula:C26H40N2O15Color and Shape:SolidMolecular weight:620.64,7,10,13,16,19,22-Heptaoxapentacosanedioic acid, 1,25-bis(2,5-dioxo-1-pyrrolidinyl) ester
CAS:<p>Bis-PEG7-NHS ester is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, Bis-PEG7-NHS ester is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.</p>Formula:C26H40N2O15Purity:Min. 97 Area-%Color and Shape:White Off-White PowderMolecular weight:620.6 g/molBis-dPEG®7-NHS Ester
CAS:<p>Bis-dPEG®7-NHS Ester is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, bis-dPEG®7-NHS Ester is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.</p>Formula:C26H40N2O15Purity:Min. 95%Molecular weight:620.6 g/mol




