CAS 1334177-80-8

1-(Phenylmethyl) 5,8,11,14,17,20-hexaoxa-2-azatricosanedioate

Description:

1-(Phenylmethyl) 5,8,11,14,17,20-hexaoxa-2-azatricosanedioate is a complex organic compound characterized by its unique structure, which includes a long carbon chain interspersed with oxygen atoms and a nitrogen atom. The presence of multiple ether linkages (indicated by the "hexaoxa" portion) suggests that the compound may exhibit significant solubility in polar solvents, while the phenylmethyl group contributes to its hydrophobic characteristics. The azatricosanedioate component indicates that the molecule contains both amine and carboxylate functionalities, which may impart interesting reactivity and potential for forming salts or complexes. This compound may be of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in drug delivery systems or as a polymer precursor. Its stability, reactivity, and interactions with biological systems would depend on the specific arrangement of its functional groups and the overall molecular conformation. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₂₃H₃₇NO₁₀

InChI: InChI=1S/C23H37NO10/c25-22(26)6-8-28-10-12-30-14-16-32-18-19-33-17-15-31-13-11-29-9-7-24-23(27)34-20-21-4-2-1-3-5-21/h1-5H,6-20H2,(H,24,27)(H,25,26)

InChI key: InChIKey=QWAOJWRYJPALAN-UHFFFAOYSA-N

SMILES: C(OC(NCCOCCOCCOCCOCCOCCOCCC(O)=O)=O)C1=CC=CC=C1

Synonyms:

• 5,8,11,14,17,20-Hexaoxa-2-azatricosanedioic acid, 1-(phenylmethyl) ester
• 1-(Phenylmethyl) 5,8,11,14,17,20-hexaoxa-2-azatricosanedioate

Cbz-N-amido-PEG6-acid

CAS: 1334177-80-8

Formula: C₂₃H₃₇NO₁₀

Purity: 98%

Color and Shape: Liquid

Molecular weight: 487.5406

Ref: IN-DA009IT4

Cbz-N-amido-PEG6-acid

CAS: 1334177-80-8

Cbz-N-amido-PEG6-acid

Purity: 95%

Molecular weight: 487.54g/mol

Ref: 54-BIPG1365

Cbz-NH-PEG6-C2-acid

CAS: 1334177-80-8

Cbz-NH-PEG6-C2-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₂₃H₃₇NO₁₀

Color and Shape: Solid

Molecular weight: 487.54

Ref: TM-T14891

3-Oxo-1-phenyl-2,7,10,13,16,19,22-heptaoxa-4-azapentacosan-25-oic acid

CAS: 1334177-80-8

Purity: 98%

Molecular weight: 487.54599

Ref: 10-F867310

Cbz-N-Amido-dPEG®6-Acid

CAS: 1334177-80-8

Cbz-N-Amido-dPEG®6-Acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Cbz-N-Amido-dPEG®6-Acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Purity: Min. 95%

Molecular weight: 487.54 g/mol

Ref: 3D-DPG-5755