CAS 1334177-80-8: 1-(Phenylmethyl) 5,8,11,14,17,20-hexaoxa-2-azatricosanedioate
Description:1-(Phenylmethyl) 5,8,11,14,17,20-hexaoxa-2-azatricosanedioate is a complex organic compound characterized by its unique structure, which includes a long carbon chain interspersed with oxygen atoms and a nitrogen atom. The presence of multiple ether linkages (indicated by the "hexaoxa" portion) suggests that the compound may exhibit significant solubility in polar solvents, while the phenylmethyl group contributes to its hydrophobic characteristics. The azatricosanedioate component indicates that the molecule contains both amine and carboxylate functionalities, which may impart interesting reactivity and potential for forming salts or complexes. This compound may be of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in drug delivery systems or as a polymer precursor. Its stability, reactivity, and interactions with biological systems would depend on the specific arrangement of its functional groups and the overall molecular conformation. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C23H37NO10
InChI:InChI=1S/C23H37NO10/c25-22(26)6-8-28-10-12-30-14-16-32-18-19-33-17-15-31-13-11-29-9-7-24-23(27)34-20-21-4-2-1-3-5-21/h1-5H,6-20H2,(H,24,27)(H,25,26)
InChI key:InChIKey=QWAOJWRYJPALAN-UHFFFAOYSA-N
SMILES:O=C(O)CCOCCOCCOCCOCCOCCOCCNC(=O)OCC=1C=CC=CC1
- Synonyms:
- 5,8,11,14,17,20-Hexaoxa-2-azatricosanedioic acid, 1-(phenylmethyl) ester
- 1-(Phenylmethyl) 5,8,11,14,17,20-hexaoxa-2-azatricosanedioate
