CAS 1334177-81-9

S-(23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl) ethanethioate

Description:

S-(23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl) ethanethioate, with the CAS number 1334177-81-9, is a chemical compound characterized by its complex structure, which includes a long hydrocarbon chain and multiple ether linkages due to the presence of seven oxygen atoms in its heptaoxatricos moiety. The compound features a thioate functional group, which is indicative of its potential reactivity and applications in various chemical processes. Its hydroxyl group contributes to its solubility in polar solvents and may influence its biological activity. The presence of multiple functional groups suggests that this compound could exhibit interesting properties, such as surfactant behavior or potential use in drug delivery systems. Additionally, the structural complexity may allow for specific interactions with biological targets, making it a candidate for further research in medicinal chemistry or materials science. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential applications.

Formula: C₁₈H₃₆O₉S

InChI: InChI=1S/C18H36O9S/c1-18(20)28-17-16-27-15-14-26-13-12-25-11-10-24-9-8-23-7-6-22-5-4-21-3-2-19/h19H,2-17H2,1H3

InChI key: InChIKey=PGTIAXGQNCASCI-UHFFFAOYSA-N

SMILES: C(COCCOCCOCCOCCOCCO)OCCOCCSC(C)=O

Synonyms:

• S-(23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl) ethanethioate
• Ethanethioic acid, S-(23-hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl) ester
• S-acetyl-PEG8 alcohol
• S-acetyl-PEG8-OH
• Ac-s-oeg-oh

S-Acetyl-PEG8-OH

CAS: 1334177-81-9

S-Acetyl-PEG8-OH is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₈H₃₆O₉S

Purity: 98%

Color and Shape: Solid

Molecular weight: 428.54

Ref: TM-T16828